Benzene, 1-isocyanato-4-octyl- (9CI)
1-isocyanato-4-octylbenzene
CAS: 69342-46-7
Molecular Formula: C15H21NO
Benzene, 1-isocyanato-4-octyl- (9CI) - Names and Identifiers
| Name | 1-isocyanato-4-octylbenzene |
| Synonyms | 1-isocyanato-4-octylbenzene 4-OCTYLPHENYL ISOCYANATE 97 Benzene, 1-isocyanato-4-octyl- Benzene, 1-isocyanato-4-octyl- (9CI) |
| CAS | 69342-46-7 |
| InChI | InChI=1/C15H21NO/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)16-13-17/h9-12H,2-8H2,1H3 |
Benzene, 1-isocyanato-4-octyl- (9CI) - Physico-chemical Properties
| Molecular Formula | C15H21NO |
| Molar Mass | 231.33 |
| Density | 0.946g/mLat 25°C(lit.) |
| Boling Point | 294-295°C(lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.0004mmHg at 25°C |
| Refractive Index | n20/D 1.5052(lit.) |
Benzene, 1-isocyanato-4-octyl- (9CI) - Risk and Safety
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. R42 - May cause sensitization by inhalation R23/24/25 - Toxic by inhalation, in contact with skin and if swallowed. |
| Safety Description | S23 - Do not breathe vapour. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37 - Wear suitable protective clothing and gloves. |
| WGK Germany | 3 |
Benzene, 1-isocyanato-4-octyl- (9CI) - Introduction
It is an organic compound whose chemical formula is C16H23NO. The following is a detailed description of its nature, use, preparation and safety information:
Nature:
1. Appearance: colorless to yellowish liquid.
2. Solubility: It has good solubility in common organic solvents.
3. Melting point and boiling point: Its melting point is -20°C, and its boiling point is 240-250°C.
4. density: its density is 0.982 g/cm.
Use:
1. It is mainly used in the field of chemical synthesis and is commonly used as an intermediate and raw material for organic synthesis.
2. It is also used to synthesize soft polyurethane materials and coatings to improve the performance of materials.
3. At the same time, it is used as a component of lubricating oil additives and antioxidants to enhance its performance.
Preparation Method:
It is usually made by reacting 4-octylbromobenzene with isocyanate. This preparation can be achieved by a base-promoted alcohol amine combination reaction.
Safety Information:
1. take safety measures during use and storage to avoid contact with skin, eyes and inhalation.
2. In case of contact, immediately flush the affected area with plenty of water and seek medical advice.
3. During operation, suitable personal protective equipment should be equipped, such as chemical protective gloves, anti-glasses and protective masks.
4. should be stored in a dry, well-ventilated place, and away from fire and heat sources.
Nature:
1. Appearance: colorless to yellowish liquid.
2. Solubility: It has good solubility in common organic solvents.
3. Melting point and boiling point: Its melting point is -20°C, and its boiling point is 240-250°C.
4. density: its density is 0.982 g/cm.
Use:
1. It is mainly used in the field of chemical synthesis and is commonly used as an intermediate and raw material for organic synthesis.
2. It is also used to synthesize soft polyurethane materials and coatings to improve the performance of materials.
3. At the same time, it is used as a component of lubricating oil additives and antioxidants to enhance its performance.
Preparation Method:
It is usually made by reacting 4-octylbromobenzene with isocyanate. This preparation can be achieved by a base-promoted alcohol amine combination reaction.
Safety Information:
1. take safety measures during use and storage to avoid contact with skin, eyes and inhalation.
2. In case of contact, immediately flush the affected area with plenty of water and seek medical advice.
3. During operation, suitable personal protective equipment should be equipped, such as chemical protective gloves, anti-glasses and protective masks.
4. should be stored in a dry, well-ventilated place, and away from fire and heat sources.
Last Update：2024-04-10 22:29:15
